About ethane;1-methyl-4-phenylbenzene;toluene
ethane;1-methyl-4-phenylbenzene;toluene (PubChem CID 157456524) has the molecular formula C26H38
and a molecular weight of 350.59 g/mol. Its IUPAC name is ethane;1-methyl-4-phenylbenzene;toluene.
Molecular Properties
| Compound Name | ethane;1-methyl-4-phenylbenzene;toluene |
| PubChem CID | 157456524 |
| Molecular Formula | C26H38 |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.30 |
| IUPAC Name | ethane;1-methyl-4-phenylbenzene;toluene |
| SMILES | CC.CC.CC.Cc1ccc(-c2ccccc2)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C13H12.C7H8.3C2H6/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-7-5-3-2-4-6-7;3*1-2/h2-10H,1H3;2-6H,1H3;3*1-2H3 |
| InChIKey | BTKNJDULNQWKJM-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-methyl-4-phenylbenzene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-4-phenylbenzene;toluene?
The IUPAC name of ethane;1-methyl-4-phenylbenzene;toluene (CID 157456524) is ethane;1-methyl-4-phenylbenzene;toluene.
What is the SMILES notation for ethane;1-methyl-4-phenylbenzene;toluene?
The canonical SMILES for ethane;1-methyl-4-phenylbenzene;toluene is CC.CC.CC.Cc1ccc(-c2ccccc2)cc1.Cc1ccccc1.
What is the InChIKey of ethane;1-methyl-4-phenylbenzene;toluene?
The InChIKey is BTKNJDULNQWKJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C7H8.3C2H6/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-7-5-3-2-4-6-7;3*1-2/h2-10H,1H3;2-6H,1H3;3*1-2H3.
What are the key properties of ethane;1-methyl-4-phenylbenzene;toluene?
ethane;1-methyl-4-phenylbenzene;toluene has a molecular weight of 350.59 g/mol, XLogP of 8.74, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-4-phenylbenzene;toluene is sourced from PubChem (CID 157456524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).