About benzene;ethane;1-methyl-4-(4-methylphenyl)benzene
benzene;ethane;1-methyl-4-(4-methylphenyl)benzene (PubChem CID 161197560) has the molecular formula C22H26
and a molecular weight of 290.45 g/mol. Its IUPAC name is benzene;ethane;1-methyl-4-(4-methylphenyl)benzene.
Molecular Properties
| Compound Name | benzene;ethane;1-methyl-4-(4-methylphenyl)benzene |
| PubChem CID | 161197560 |
| Molecular Formula | C22H26 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | benzene;ethane;1-methyl-4-(4-methylphenyl)benzene |
| SMILES | CC.Cc1ccc(-c2ccc(C)cc2)cc1.c1ccccc1 |
| InChI | InChI=1S/C14H14.C6H6.C2H6/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-2-4-6-5-3-1;1-2/h3-10H,1-2H3;1-6H;1-2H3 |
| InChIKey | UUNXHGPAYHBGIR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze benzene;ethane;1-methyl-4-(4-methylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethane;1-methyl-4-(4-methylphenyl)benzene?
The IUPAC name of benzene;ethane;1-methyl-4-(4-methylphenyl)benzene (CID 161197560) is benzene;ethane;1-methyl-4-(4-methylphenyl)benzene.
What is the SMILES notation for benzene;ethane;1-methyl-4-(4-methylphenyl)benzene?
The canonical SMILES for benzene;ethane;1-methyl-4-(4-methylphenyl)benzene is CC.Cc1ccc(-c2ccc(C)cc2)cc1.c1ccccc1.
What is the InChIKey of benzene;ethane;1-methyl-4-(4-methylphenyl)benzene?
The InChIKey is UUNXHGPAYHBGIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C6H6.C2H6/c1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-2-4-6-5-3-1;1-2/h3-10H,1-2H3;1-6H;1-2H3.
What are the key properties of benzene;ethane;1-methyl-4-(4-methylphenyl)benzene?
benzene;ethane;1-methyl-4-(4-methylphenyl)benzene has a molecular weight of 290.45 g/mol, XLogP of 6.68, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethane;1-methyl-4-(4-methylphenyl)benzene is sourced from PubChem (CID 161197560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).