C21H30 — CID 143599647
buta-1,3-diene;ethane;1-methyl-4-phenylbenzene (PubChem CID 143599647) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is buta-1,3-diene;ethane;1-methyl-4-phenylbenzene.
| Compound Name | buta-1,3-diene;ethane;1-methyl-4-phenylbenzene |
|---|---|
| PubChem CID | 143599647 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | buta-1,3-diene;ethane;1-methyl-4-phenylbenzene |
| SMILES | C=CC=C.CC.CC.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C4H6.2C2H6/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-3-4-2;2*1-2/h2-10H,1H3;3-4H,1-2H2;2*1-2H3 |
| InChIKey | BOKQINDVZXJFAF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|