About ethane;methane;1-methyl-4-phenylbenzene
ethane;methane;1-methyl-4-phenylbenzene (PubChem CID 143611995) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is ethane;methane;1-methyl-4-phenylbenzene.
Molecular Properties
| Compound Name | ethane;methane;1-methyl-4-phenylbenzene |
| PubChem CID | 143611995 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | ethane;methane;1-methyl-4-phenylbenzene |
| SMILES | C.CC.CC.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.2C2H6.CH4/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;2*1-2;/h2-10H,1H3;2*1-2H3;1H4 |
| InChIKey | VHHZGMLAWFJBDE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;methane;1-methyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;1-methyl-4-phenylbenzene?
The IUPAC name of ethane;methane;1-methyl-4-phenylbenzene (CID 143611995) is ethane;methane;1-methyl-4-phenylbenzene.
What is the SMILES notation for ethane;methane;1-methyl-4-phenylbenzene?
The canonical SMILES for ethane;methane;1-methyl-4-phenylbenzene is C.CC.CC.Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of ethane;methane;1-methyl-4-phenylbenzene?
The InChIKey is VHHZGMLAWFJBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.2C2H6.CH4/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;2*1-2;/h2-10H,1H3;2*1-2H3;1H4.
What are the key properties of ethane;methane;1-methyl-4-phenylbenzene?
ethane;methane;1-methyl-4-phenylbenzene has a molecular weight of 244.42 g/mol, XLogP of 6.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;1-methyl-4-phenylbenzene is sourced from PubChem (CID 143611995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).