About dimethylphosphane;1-methyl-4-phenylbenzene
dimethylphosphane;1-methyl-4-phenylbenzene (PubChem CID 143300886) has the molecular formula C15H19P
and a molecular weight of 230.29 g/mol. Its IUPAC name is dimethylphosphane;1-methyl-4-phenylbenzene.
Molecular Properties
| Compound Name | dimethylphosphane;1-methyl-4-phenylbenzene |
| PubChem CID | 143300886 |
| Molecular Formula | C15H19P |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | dimethylphosphane;1-methyl-4-phenylbenzene |
| SMILES | CPC.Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C2H7P/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-3-2/h2-10H,1H3;3H,1-2H3 |
| InChIKey | POBQEKVJNXEQOP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylphosphane;1-methyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylphosphane;1-methyl-4-phenylbenzene?
The IUPAC name of dimethylphosphane;1-methyl-4-phenylbenzene (CID 143300886) is dimethylphosphane;1-methyl-4-phenylbenzene.
What is the SMILES notation for dimethylphosphane;1-methyl-4-phenylbenzene?
The canonical SMILES for dimethylphosphane;1-methyl-4-phenylbenzene is CPC.Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of dimethylphosphane;1-methyl-4-phenylbenzene?
The InChIKey is POBQEKVJNXEQOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C2H7P/c1-11-7-9-13(10-8-11)12-5-3-2-4-6-12;1-3-2/h2-10H,1H3;3H,1-2H3.
What are the key properties of dimethylphosphane;1-methyl-4-phenylbenzene?
dimethylphosphane;1-methyl-4-phenylbenzene has a molecular weight of 230.29 g/mol, XLogP of 4.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphane;1-methyl-4-phenylbenzene is sourced from PubChem (CID 143300886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).