C19H16O2S — CID 2801718
1-methyl-4-(4-phenylphenyl)sulfonylbenzene (PubChem CID 2801718) has the molecular formula C19H16O2S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-methyl-4-(4-phenylphenyl)sulfonylbenzene.
| Compound Name | 1-methyl-4-(4-phenylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 2801718 |
| Molecular Formula | C19H16O2S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-methyl-4-(4-phenylphenyl)sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C19H16O2S/c1-15-7-11-18(12-8-15)22(20,21)19-13-9-17(10-14-19)16-5-3-2-4-6-16/h2-14H,1H3 |
| InChIKey | FJXDTDJMXJBRFA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |