C15H18O3S — CID 157486771
methanol;1-methyl-4-(4-methylphenyl)sulfonylbenzene (PubChem CID 157486771) has the molecular formula C15H18O3S and a molecular weight of 278.37 g/mol. Its IUPAC name is methanol;1-methyl-4-(4-methylphenyl)sulfonylbenzene.
| Compound Name | methanol;1-methyl-4-(4-methylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 157486771 |
| Molecular Formula | C15H18O3S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | methanol;1-methyl-4-(4-methylphenyl)sulfonylbenzene |
| SMILES | CO.Cc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14O2S.CH4O/c1-11-3-7-13(8-4-11)17(15,16)14-9-5-12(2)6-10-14;1-2/h3-10H,1-2H3;2H,1H3 |
| InChIKey | BWUQUWDTNLCYDI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |