C24H26O4S2 — CID 10972270
1,2,4,5-tetramethyl-3,6-bis-(4-methylphenyl)sulfonylbenzene (PubChem CID 10972270) has the molecular formula C24H26O4S2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-3,6-bis-(4-methylphenyl)sulfonylbenzene.
| Compound Name | 1,2,4,5-tetramethyl-3,6-bis-(4-methylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 10972270 |
| Molecular Formula | C24H26O4S2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 1,2,4,5-tetramethyl-3,6-bis-(4-methylphenyl)sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2c(C)c(C)c(S(=O)(=O)c3ccc(C)cc3)c(C)c2C)cc1 |
| InChI | InChI=1S/C24H26O4S2/c1-15-7-11-21(12-8-15)29(25,26)23-17(3)19(5)24(20(6)18(23)4)30(27,28)22-13-9-16(2)10-14-22/h7-14H,1-6H3 |
| InChIKey | VNFKBOUYHWDCOY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |