C28H28O2S — CID 158182934
1-methyl-4-(4-methylphenyl)benzene;1-methyl-4-(4-methylphenyl)sulfonylbenzene (PubChem CID 158182934) has the molecular formula C28H28O2S and a molecular weight of 428.60 g/mol. Its IUPAC name is 1-methyl-4-(4-methylphenyl)benzene;1-methyl-4-(4-methylphenyl)sulfonylbenzene.
| Compound Name | 1-methyl-4-(4-methylphenyl)benzene;1-methyl-4-(4-methylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 158182934 |
| Molecular Formula | C28H28O2S |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-methyl-4-(4-methylphenyl)benzene;1-methyl-4-(4-methylphenyl)sulfonylbenzene |
| SMILES | Cc1ccc(-c2ccc(C)cc2)cc1.Cc1ccc(S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C14H14O2S.C14H14/c1-11-3-7-13(8-4-11)17(15,16)14-9-5-12(2)6-10-14;1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14/h3-10H,1-2H3;3-10H,1-2H3 |
| InChIKey | FYUWIEKNWUPJRS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |