C25H20O6S3 — CID 147906437
1,3-bis(benzenesulfonyl)-5-(4-methylphenyl)sulfonylbenzene (PubChem CID 147906437) has the molecular formula C25H20O6S3 and a molecular weight of 512.63 g/mol. Its IUPAC name is 1,3-bis(benzenesulfonyl)-5-(4-methylphenyl)sulfonylbenzene.
| Compound Name | 1,3-bis(benzenesulfonyl)-5-(4-methylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 147906437 |
| Molecular Formula | C25H20O6S3 |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 1,3-bis(benzenesulfonyl)-5-(4-methylphenyl)sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2cc(S(=O)(=O)c3ccccc3)cc(S(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H20O6S3/c1-19-12-14-22(15-13-19)34(30,31)25-17-23(32(26,27)20-8-4-2-5-9-20)16-24(18-25)33(28,29)21-10-6-3-7-11-21/h2-18H,1H3 |
| InChIKey | IFHAICUCFURVRT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |