C26H22O6S3 — CID 2252474
1-methyl-4-[4-[4-(4-methylphenyl)sulfonylphenyl]sulfonylphenyl]sulfonylbenzene (PubChem CID 2252474) has the molecular formula C26H22O6S3 and a molecular weight of 526.66 g/mol. Its IUPAC name is 1-methyl-4-[4-[4-(4-methylphenyl)sulfonylphenyl]sulfonylphenyl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[4-[4-(4-methylphenyl)sulfonylphenyl]sulfonylphenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 2252474 |
| Molecular Formula | C26H22O6S3 |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 1-methyl-4-[4-[4-(4-methylphenyl)sulfonylphenyl]sulfonylphenyl]sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(S(=O)(=O)c3ccc(S(=O)(=O)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H22O6S3/c1-19-3-7-21(8-4-19)33(27,28)23-11-15-25(16-12-23)35(31,32)26-17-13-24(14-18-26)34(29,30)22-9-5-20(2)6-10-22/h3-18H,1-2H3 |
| InChIKey | OIQILABLZYBKKB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |