C16H18O2S — CID 12648459
1-methyl-4-(4-propan-2-ylphenyl)sulfonylbenzene (PubChem CID 12648459) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is 1-methyl-4-(4-propan-2-ylphenyl)sulfonylbenzene.
| Compound Name | 1-methyl-4-(4-propan-2-ylphenyl)sulfonylbenzene |
|---|---|
| PubChem CID | 12648459 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-methyl-4-(4-propan-2-ylphenyl)sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C16H18O2S/c1-12(2)14-6-10-16(11-7-14)19(17,18)15-8-4-13(3)5-9-15/h4-12H,1-3H3 |
| InChIKey | SQCZNJYMUGIDKB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |