About 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide
1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide (PubChem CID 175881712) has the molecular formula C10H14I3Ru
and a molecular weight of 616.00 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide |
| PubChem CID | 175881712 |
| Molecular Formula | C10H14I3Ru |
| Molecular Weight | 616.00 g/mol |
| Exact Mass | 616.73 |
| IUPAC Name | 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide |
| SMILES | Cc1ccc(C(C)C)cc1.[I-].[I-].[I-].[Ru+3] |
| InChI | InChI=1S/C10H14.3HI.Ru/c1-8(2)10-6-4-9(3)5-7-10;;;;/h4-8H,1-3H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | BTCKCTXUWCUFPZ-UHFFFAOYSA-K |
| XLogP | -5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 616.00 |
| LogP ≤ 5 | -5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide?
The IUPAC name of 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide (CID 175881712) is 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide.
What is the SMILES notation for 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide?
The canonical SMILES for 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide is Cc1ccc(C(C)C)cc1.[I-].[I-].[I-].[Ru+3].
What is the InChIKey of 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide?
The InChIKey is BTCKCTXUWCUFPZ-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H14.3HI.Ru/c1-8(2)10-6-4-9(3)5-7-10;;;;/h4-8H,1-3H3;3*1H;/q;;;;+3/p-3.
What are the key properties of 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide?
1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide has a molecular weight of 616.00 g/mol, XLogP of -5.87, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylbenzene;ruthenium(3+);triiodide is sourced from PubChem (CID 175881712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).