About chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane
chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane (PubChem CID 12995384) has the molecular formula C16H18ClI
and a molecular weight of 372.68 g/mol. Its IUPAC name is chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane.
Molecular Properties
| Compound Name | chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane |
| PubChem CID | 12995384 |
| Molecular Formula | C16H18ClI |
| Molecular Weight | 372.68 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane |
| SMILES | Cc1ccc(I(Cl)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C16H18ClI/c1-12(2)14-6-10-16(11-7-14)18(17)15-8-4-13(3)5-9-15/h4-12H,1-3H3 |
| InChIKey | ZBCXNBUCWMDZAJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane?
The IUPAC name of chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane (CID 12995384) is chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane.
What is the SMILES notation for chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane?
The canonical SMILES for chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane is Cc1ccc(I(Cl)c2ccc(C(C)C)cc2)cc1.
What is the InChIKey of chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane?
The InChIKey is ZBCXNBUCWMDZAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClI/c1-12(2)14-6-10-16(11-7-14)18(17)15-8-4-13(3)5-9-15/h4-12H,1-3H3.
What are the key properties of chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane?
chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane has a molecular weight of 372.68 g/mol, XLogP of 5.82, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(4-methylphenyl)-(4-propan-2-ylphenyl)-λ3-iodane is sourced from PubChem (CID 12995384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).