C19H29O+ — CID 163240911
ethane;(4-propan-2-ylphenyl)oxidanium;1,4-xylene (PubChem CID 163240911) has the molecular formula C19H29O+ and a molecular weight of 273.44 g/mol. Its IUPAC name is ethane;(4-propan-2-ylphenyl)oxidanium;1,4-xylene.
| Compound Name | ethane;(4-propan-2-ylphenyl)oxidanium;1,4-xylene |
|---|---|
| PubChem CID | 163240911 |
| Molecular Formula | C19H29O+ |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | ethane;(4-propan-2-ylphenyl)oxidanium;1,4-xylene |
| SMILES | CC.CC(C)c1ccc([OH2+])cc1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H12O.C8H10.C2H6/c1-7(2)8-3-5-9(10)6-4-8;1-7-3-5-8(2)6-4-7;1-2/h3-7,10H,1-2H3;3-6H,1-2H3;1-2H3/p+1 |
| InChIKey | IAFVWUPPFZRVJJ-UHFFFAOYSA-O |
| XLogP | 5.58 |
| TPSA | 22.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|