About 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride
1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride (PubChem CID 11551268) has the molecular formula C10H14Cl2Ru
and a molecular weight of 306.20 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride |
| PubChem CID | 11551268 |
| Molecular Formula | C10H14Cl2Ru |
| Molecular Weight | 306.20 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride |
| SMILES | Cc1ccc(C(C)C)cc1.[Cl-].[Cl-].[Ru+2] |
| InChI | InChI=1S/C10H14.2ClH.Ru/c1-8(2)10-6-4-9(3)5-7-10;;;/h4-8H,1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | UCXDWSTYBSBFFB-UHFFFAOYSA-L |
| XLogP | -2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.20 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride?
The IUPAC name of 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride (CID 11551268) is 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride.
What is the SMILES notation for 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride?
The canonical SMILES for 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride is Cc1ccc(C(C)C)cc1.[Cl-].[Cl-].[Ru+2].
What is the InChIKey of 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride?
The InChIKey is UCXDWSTYBSBFFB-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H14.2ClH.Ru/c1-8(2)10-6-4-9(3)5-7-10;;;/h4-8H,1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride?
1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride has a molecular weight of 306.20 g/mol, XLogP of -2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylbenzene;ruthenium(2+);dichloride is sourced from PubChem (CID 11551268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).