About 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide
1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide (PubChem CID 175953909) has the molecular formula C10H16I2Ru
and a molecular weight of 491.12 g/mol. Its IUPAC name is 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide.
Molecular Properties
| Compound Name | 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide |
| PubChem CID | 175953909 |
| Molecular Formula | C10H16I2Ru |
| Molecular Weight | 491.12 g/mol |
| Exact Mass | 491.84 |
| IUPAC Name | 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide |
| SMILES | Cc1ccc(C(C)C)cc1.I.I.[Ru] |
| InChI | InChI=1S/C10H14.2HI.Ru/c1-8(2)10-6-4-9(3)5-7-10;;;/h4-8H,1-3H3;2*1H; |
| InChIKey | VKGQDSGHAOJAIZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.12 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide?
The IUPAC name of 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide (CID 175953909) is 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide.
What is the SMILES notation for 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide?
The canonical SMILES for 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide is Cc1ccc(C(C)C)cc1.I.I.[Ru].
What is the InChIKey of 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide?
The InChIKey is VKGQDSGHAOJAIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.2HI.Ru/c1-8(2)10-6-4-9(3)5-7-10;;;/h4-8H,1-3H3;2*1H;.
What are the key properties of 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide?
1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide has a molecular weight of 491.12 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-propan-2-ylbenzene;ruthenium;dihydroiodide is sourced from PubChem (CID 175953909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).