About aniline;1-methyl-4-propan-2-ylbenzene
aniline;1-methyl-4-propan-2-ylbenzene (PubChem CID 19435769) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is aniline;1-methyl-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | aniline;1-methyl-4-propan-2-ylbenzene |
| PubChem CID | 19435769 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | aniline;1-methyl-4-propan-2-ylbenzene |
| SMILES | Cc1ccc(C(C)C)cc1.Nc1ccccc1 |
| InChI | InChI=1S/C10H14.C6H7N/c1-8(2)10-6-4-9(3)5-7-10;7-6-4-2-1-3-5-6/h4-8H,1-3H3;1-5H,7H2 |
| InChIKey | OKTFKKCGVYKLRR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;1-methyl-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;1-methyl-4-propan-2-ylbenzene?
The IUPAC name of aniline;1-methyl-4-propan-2-ylbenzene (CID 19435769) is aniline;1-methyl-4-propan-2-ylbenzene.
What is the SMILES notation for aniline;1-methyl-4-propan-2-ylbenzene?
The canonical SMILES for aniline;1-methyl-4-propan-2-ylbenzene is Cc1ccc(C(C)C)cc1.Nc1ccccc1.
What is the InChIKey of aniline;1-methyl-4-propan-2-ylbenzene?
The InChIKey is OKTFKKCGVYKLRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C6H7N/c1-8(2)10-6-4-9(3)5-7-10;7-6-4-2-1-3-5-6/h4-8H,1-3H3;1-5H,7H2.
What are the key properties of aniline;1-methyl-4-propan-2-ylbenzene?
aniline;1-methyl-4-propan-2-ylbenzene has a molecular weight of 227.35 g/mol, XLogP of 4.39, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;1-methyl-4-propan-2-ylbenzene is sourced from PubChem (CID 19435769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).