C18H24NO2S+ — CID 9168606
[(2S)-2-(4-methylphenyl)sulfonyl-2-(4-propan-2-ylphenyl)ethyl]azanium (PubChem CID 9168606) has the molecular formula C18H24NO2S+ and a molecular weight of 318.46 g/mol. Its IUPAC name is [(2S)-2-(4-methylphenyl)sulfonyl-2-(4-propan-2-ylphenyl)ethyl]azanium.
| Compound Name | [(2S)-2-(4-methylphenyl)sulfonyl-2-(4-propan-2-ylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9168606 |
| Molecular Formula | C18H24NO2S+ |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(2S)-2-(4-methylphenyl)sulfonyl-2-(4-propan-2-ylphenyl)ethyl]azanium |
| SMILES | Cc1ccc(S(=O)(=O)[C@H](C[NH3+])c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C18H23NO2S/c1-13(2)15-6-8-16(9-7-15)18(12-19)22(20,21)17-10-4-14(3)5-11-17/h4-11,13,18H,12,19H2,1-3H3/p+1/t18-/m1/s1 |
| InChIKey | PAZIMRBVPPZRIL-GOSISDBHSA-O |
| XLogP | 2.88 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |