C15H17FNO2S+ — CID 9161837
[(2R)-2-(4-fluorophenyl)sulfonyl-2-(3-methylphenyl)ethyl]azanium (PubChem CID 9161837) has the molecular formula C15H17FNO2S+ and a molecular weight of 294.37 g/mol. Its IUPAC name is [(2R)-2-(4-fluorophenyl)sulfonyl-2-(3-methylphenyl)ethyl]azanium.
| Compound Name | [(2R)-2-(4-fluorophenyl)sulfonyl-2-(3-methylphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 9161837 |
| Molecular Formula | C15H17FNO2S+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(2R)-2-(4-fluorophenyl)sulfonyl-2-(3-methylphenyl)ethyl]azanium |
| SMILES | Cc1cccc([C@H](C[NH3+])S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C15H16FNO2S/c1-11-3-2-4-12(9-11)15(10-17)20(18,19)14-7-5-13(16)6-8-14/h2-9,15H,10,17H2,1H3/p+1/t15-/m0/s1 |
| InChIKey | LPIHFELLBOVVKI-HNNXBMFYSA-O |
| XLogP | 1.89 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |