C12H13FNO2S2+ — CID 9079080
[(2S)-2-(4-fluorophenyl)sulfonyl-2-thiophen-2-ylethyl]azanium (PubChem CID 9079080) has the molecular formula C12H13FNO2S2+ and a molecular weight of 286.37 g/mol. Its IUPAC name is [(2S)-2-(4-fluorophenyl)sulfonyl-2-thiophen-2-ylethyl]azanium.
| Compound Name | [(2S)-2-(4-fluorophenyl)sulfonyl-2-thiophen-2-ylethyl]azanium |
|---|---|
| PubChem CID | 9079080 |
| Molecular Formula | C12H13FNO2S2+ |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [(2S)-2-(4-fluorophenyl)sulfonyl-2-thiophen-2-ylethyl]azanium |
| SMILES | [NH3+]C[C@@H](c1cccs1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12FNO2S2/c13-9-3-5-10(6-4-9)18(15,16)12(8-14)11-2-1-7-17-11/h1-7,12H,8,14H2/p+1/t12-/m0/s1 |
| InChIKey | IVBBEEXDNGKOBP-LBPRGKRZSA-O |
| XLogP | 1.64 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |