C19H18FNO4S3 — CID 16829644
4-fluoro-N-[2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]benzenesulfonamide (PubChem CID 16829644) has the molecular formula C19H18FNO4S3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-fluoro-N-[2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16829644 |
| Molecular Formula | C19H18FNO4S3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 4-fluoro-N-[2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)C(CNS(=O)(=O)c2ccc(F)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C19H18FNO4S3/c1-14-4-8-16(9-5-14)27(22,23)19(18-3-2-12-26-18)13-21-28(24,25)17-10-6-15(20)7-11-17/h2-12,19,21H,13H2,1H3 |
| InChIKey | IOPKRUBSAUGIEE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |