C18H15ClFNO4S3 — CID 16829653
N-[2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-4-fluorobenzenesulfonamide (PubChem CID 16829653) has the molecular formula C18H15ClFNO4S3 and a molecular weight of 459.97 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 16829653 |
| Molecular Formula | C18H15ClFNO4S3 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC(c1cccs1)S(=O)(=O)c1ccc(Cl)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15ClFNO4S3/c19-13-3-7-15(8-4-13)27(22,23)18(17-2-1-11-26-17)12-21-28(24,25)16-9-5-14(20)6-10-16/h1-11,18,21H,12H2 |
| InChIKey | CDXFDHMWUMMZDJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |