C17H16FNO4S4 — CID 18574253
4-fluoro-3-methyl-N-(2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide (PubChem CID 18574253) has the molecular formula C17H16FNO4S4 and a molecular weight of 445.58 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-(2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-3-methyl-N-(2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 18574253 |
| Molecular Formula | C17H16FNO4S4 |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 444.99 |
| IUPAC Name | 4-fluoro-3-methyl-N-(2-thiophen-2-yl-2-thiophen-2-ylsulfonylethyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(c2cccs2)S(=O)(=O)c2cccs2)ccc1F |
| InChI | InChI=1S/C17H16FNO4S4/c1-12-10-13(6-7-14(12)18)27(22,23)19-11-16(15-4-2-8-24-15)26(20,21)17-5-3-9-25-17/h2-10,16,19H,11H2,1H3 |
| InChIKey | BQLCQALRSQWSKU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |