C17H20FNO3S2 — CID 20962872
N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]-2-methylpropanamide (PubChem CID 20962872) has the molecular formula C17H20FNO3S2 and a molecular weight of 369.48 g/mol. Its IUPAC name is N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]-2-methylpropanamide.
| Compound Name | N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 20962872 |
| Molecular Formula | C17H20FNO3S2 |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-[2-(4-fluoro-3-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]-2-methylpropanamide |
| SMILES | Cc1cc(S(=O)(=O)C(CNC(=O)C(C)C)c2cccs2)ccc1F |
| InChI | InChI=1S/C17H20FNO3S2/c1-11(2)17(20)19-10-16(15-5-4-8-23-15)24(21,22)13-6-7-14(18)12(3)9-13/h4-9,11,16H,10H2,1-3H3,(H,19,20) |
| InChIKey | KVJAQDZTGXWRMW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |