C19H22N2O4S2 — CID 9162725
N'-cyclopropyl-N-[(2S)-2-(3,4-dimethylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide (PubChem CID 9162725) has the molecular formula C19H22N2O4S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N'-cyclopropyl-N-[(2S)-2-(3,4-dimethylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[(2S)-2-(3,4-dimethylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide |
|---|---|
| PubChem CID | 9162725 |
| Molecular Formula | C19H22N2O4S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N'-cyclopropyl-N-[(2S)-2-(3,4-dimethylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H](CNC(=O)C(=O)NC2CC2)c2cccs2)cc1C |
| InChI | InChI=1S/C19H22N2O4S2/c1-12-5-8-15(10-13(12)2)27(24,25)17(16-4-3-9-26-16)11-20-18(22)19(23)21-14-6-7-14/h3-5,8-10,14,17H,6-7,11H2,1-2H3,(H,20,22)(H,21,23)/t17-/m0/s1 |
| InChIKey | QOZKAXZDAXJIRM-KRWDZBQOSA-N |
| XLogP | 2.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|