C20H23ClN2O4S2 — CID 92693458
N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-N'-cyclohexyloxamide (PubChem CID 92693458) has the molecular formula C20H23ClN2O4S2 and a molecular weight of 455.00 g/mol. Its IUPAC name is N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-N'-cyclohexyloxamide.
| Compound Name | N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-N'-cyclohexyloxamide |
|---|---|
| PubChem CID | 92693458 |
| Molecular Formula | C20H23ClN2O4S2 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | N-[(2S)-2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-N'-cyclohexyloxamide |
| SMILES | O=C(NC[C@@H](c1cccs1)S(=O)(=O)c1ccc(Cl)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H23ClN2O4S2/c21-14-8-10-16(11-9-14)29(26,27)18(17-7-4-12-28-17)13-22-19(24)20(25)23-15-5-2-1-3-6-15/h4,7-12,15,18H,1-3,5-6,13H2,(H,22,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | ISASTMZQVAQXND-SFHVURJKSA-N |
| XLogP | 3.48 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|