C17H19ClN2O4S2 — CID 22584057
N-[2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-N'-propan-2-yloxamide (PubChem CID 22584057) has the molecular formula C17H19ClN2O4S2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-N'-propan-2-yloxamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 22584057 |
| Molecular Formula | C17H19ClN2O4S2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfonyl-2-thiophen-2-ylethyl]-N'-propan-2-yloxamide |
| SMILES | CC(C)NC(=O)C(=O)NCC(c1cccs1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H19ClN2O4S2/c1-11(2)20-17(22)16(21)19-10-15(14-4-3-9-25-14)26(23,24)13-7-5-12(18)6-8-13/h3-9,11,15H,10H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | DHZDOSURGXDJQP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|