C21H20ClNO3S2 — CID 40774735
2-(4-chlorophenyl)-N-[(2S)-2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]acetamide (PubChem CID 40774735) has the molecular formula C21H20ClNO3S2 and a molecular weight of 433.98 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2S)-2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(2S)-2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 40774735 |
| Molecular Formula | C21H20ClNO3S2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.06 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2S)-2-(4-methylphenyl)sulfonyl-2-thiophen-2-ylethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H](CNC(=O)Cc2ccc(Cl)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H20ClNO3S2/c1-15-4-10-18(11-5-15)28(25,26)20(19-3-2-12-27-19)14-23-21(24)13-16-6-8-17(22)9-7-16/h2-12,20H,13-14H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | DNPRKSYHGAFBTA-FQEVSTJZSA-N |
| XLogP | 4.58 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |