C18H22N2O4S2 — CID 9167656
N-methyl-N'-[(2R)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide (PubChem CID 9167656) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-methyl-N'-[(2R)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide.
| Compound Name | N-methyl-N'-[(2R)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide |
|---|---|
| PubChem CID | 9167656 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N-methyl-N'-[(2R)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]oxamide |
| SMILES | CNC(=O)C(=O)NC[C@H](c1cccs1)S(=O)(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-12(2)13-6-8-14(9-7-13)26(23,24)16(15-5-4-10-25-15)11-20-18(22)17(21)19-3/h4-10,12,16H,11H2,1-3H3,(H,19,21)(H,20,22)/t16-/m1/s1 |
| InChIKey | WTYKXXIYUJWXIV-MRXNPFEDSA-N |
| XLogP | 2.25 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|