C19H26N2O3S2 — CID 9167607
1-[(2S)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]-3-propylurea (PubChem CID 9167607) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-[(2S)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]-3-propylurea.
| Compound Name | 1-[(2S)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]-3-propylurea |
|---|---|
| PubChem CID | 9167607 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 1-[(2S)-2-(4-propan-2-ylphenyl)sulfonyl-2-thiophen-2-ylethyl]-3-propylurea |
| SMILES | CCCNC(=O)NC[C@@H](c1cccs1)S(=O)(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O3S2/c1-4-11-20-19(22)21-13-18(17-6-5-12-25-17)26(23,24)16-9-7-15(8-10-16)14(2)3/h5-10,12,14,18H,4,11,13H2,1-3H3,(H2,20,21,22)/t18-/m0/s1 |
| InChIKey | ODTZTVHIFRNURJ-SFHVURJKSA-N |
| XLogP | 4.10 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |