C18H24N2O3S2 — CID 9168430
1-[(2R)-2-(2,5-dimethylphenyl)sulfonyl-2-thiophen-2-ylethyl]-3-propylurea (PubChem CID 9168430) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 1-[(2R)-2-(2,5-dimethylphenyl)sulfonyl-2-thiophen-2-ylethyl]-3-propylurea.
| Compound Name | 1-[(2R)-2-(2,5-dimethylphenyl)sulfonyl-2-thiophen-2-ylethyl]-3-propylurea |
|---|---|
| PubChem CID | 9168430 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 1-[(2R)-2-(2,5-dimethylphenyl)sulfonyl-2-thiophen-2-ylethyl]-3-propylurea |
| SMILES | CCCNC(=O)NC[C@H](c1cccs1)S(=O)(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C18H24N2O3S2/c1-4-9-19-18(21)20-12-17(15-6-5-10-24-15)25(22,23)16-11-13(2)7-8-14(16)3/h5-8,10-11,17H,4,9,12H2,1-3H3,(H2,19,20,21)/t17-/m1/s1 |
| InChIKey | SKHLXISBLRHBEO-QGZVFWFLSA-N |
| XLogP | 3.59 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |