C18H22N2O4S2 — CID 9181718
N'-[(2R)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]-N-propyloxamide (PubChem CID 9181718) has the molecular formula C18H22N2O4S2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N'-[(2R)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]-N-propyloxamide.
| Compound Name | N'-[(2R)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]-N-propyloxamide |
|---|---|
| PubChem CID | 9181718 |
| Molecular Formula | C18H22N2O4S2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | N'-[(2R)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NC[C@@H](c1ccc(C)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H22N2O4S2/c1-3-10-19-17(21)18(22)20-12-15(14-8-6-13(2)7-9-14)26(23,24)16-5-4-11-25-16/h4-9,11,15H,3,10,12H2,1-2H3,(H,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | DETPRVXAOUJVQA-HNNXBMFYSA-N |
| XLogP | 2.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|