C21H21NO3S2 — CID 9181313
3-methyl-N-[(2R)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]benzamide (PubChem CID 9181313) has the molecular formula C21H21NO3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is 3-methyl-N-[(2R)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]benzamide.
| Compound Name | 3-methyl-N-[(2R)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]benzamide |
|---|---|
| PubChem CID | 9181313 |
| Molecular Formula | C21H21NO3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 3-methyl-N-[(2R)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]benzamide |
| SMILES | Cc1ccc([C@H](CNC(=O)c2cccc(C)c2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C21H21NO3S2/c1-15-8-10-17(11-9-15)19(27(24,25)20-7-4-12-26-20)14-22-21(23)18-6-3-5-16(2)13-18/h3-13,19H,14H2,1-2H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | MVJAOEYUHQITPQ-IBGZPJMESA-N |
| XLogP | 4.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |