C15H17NO3S2 — CID 9181107
N-[(2S)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]acetamide (PubChem CID 9181107) has the molecular formula C15H17NO3S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-[(2S)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]acetamide.
| Compound Name | N-[(2S)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]acetamide |
|---|---|
| PubChem CID | 9181107 |
| Molecular Formula | C15H17NO3S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-[(2S)-2-(4-methylphenyl)-2-thiophen-2-ylsulfonylethyl]acetamide |
| SMILES | CC(=O)NC[C@H](c1ccc(C)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C15H17NO3S2/c1-11-5-7-13(8-6-11)14(10-16-12(2)17)21(18,19)15-4-3-9-20-15/h3-9,14H,10H2,1-2H3,(H,16,17)/t14-/m1/s1 |
| InChIKey | PVRFGMVTATURRJ-CQSZACIVSA-N |
| XLogP | 2.71 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |