C22H21NO3S2 — CID 9180498
(E)-3-(4-methylphenyl)-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]prop-2-enamide (PubChem CID 9180498) has the molecular formula C22H21NO3S2 and a molecular weight of 411.55 g/mol. Its IUPAC name is (E)-3-(4-methylphenyl)-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methylphenyl)-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9180498 |
| Molecular Formula | C22H21NO3S2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (E)-3-(4-methylphenyl)-N-[(2R)-2-phenyl-2-thiophen-2-ylsulfonylethyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC[C@@H](c2ccccc2)S(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C22H21NO3S2/c1-17-9-11-18(12-10-17)13-14-21(24)23-16-20(19-6-3-2-4-7-19)28(25,26)22-8-5-15-27-22/h2-15,20H,16H2,1H3,(H,23,24)/b14-13+/t20-/m0/s1 |
| InChIKey | KEWDJUFCGHGDED-AIGDTVQASA-N |
| XLogP | 4.40 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|