C20H18N2O3S2 — CID 9152454
(E)-3-phenyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]prop-2-enamide (PubChem CID 9152454) has the molecular formula C20H18N2O3S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is (E)-3-phenyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]prop-2-enamide.
| Compound Name | (E)-3-phenyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9152454 |
| Molecular Formula | C20H18N2O3S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | (E)-3-phenyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC[C@@H](c1cccnc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H18N2O3S2/c23-19(11-10-16-6-2-1-3-7-16)22-15-18(17-8-4-12-21-14-17)27(24,25)20-9-5-13-26-20/h1-14,18H,15H2,(H,22,23)/b11-10+/t18-/m0/s1 |
| InChIKey | OBFQEMZZZXPAMO-ZGKFYVQTSA-N |
| XLogP | 3.49 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|