C17H15N3O3S2 — CID 9152316
N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]pyridine-3-carboxamide (PubChem CID 9152316) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]pyridine-3-carboxamide.
| Compound Name | N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9152316 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]pyridine-3-carboxamide |
| SMILES | O=C(NC[C@@H](c1cccnc1)S(=O)(=O)c1cccs1)c1cccnc1 |
| InChI | InChI=1S/C17H15N3O3S2/c21-17(14-5-2-8-19-11-14)20-12-15(13-4-1-7-18-10-13)25(22,23)16-6-3-9-24-16/h1-11,15H,12H2,(H,20,21)/t15-/m0/s1 |
| InChIKey | VTBJRHDVHJZDBY-HNNXBMFYSA-N |
| XLogP | 2.48 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |