C13H14N2O3S2 — CID 9151748
N-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]acetamide (PubChem CID 9151748) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]acetamide.
| Compound Name | N-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]acetamide |
|---|---|
| PubChem CID | 9151748 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | N-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]acetamide |
| SMILES | CC(=O)NC[C@H](c1cccnc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-10(16)15-9-12(11-4-2-6-14-8-11)20(17,18)13-5-3-7-19-13/h2-8,12H,9H2,1H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | ZTSBIMVXCLBHMA-GFCCVEGCSA-N |
| XLogP | 1.79 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |