C17H21N3O4S2 — CID 9152743
N-(2-methylpropyl)-N'-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]oxamide (PubChem CID 9152743) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is N-(2-methylpropyl)-N'-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]oxamide.
| Compound Name | N-(2-methylpropyl)-N'-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]oxamide |
|---|---|
| PubChem CID | 9152743 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-(2-methylpropyl)-N'-[(2S)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]oxamide |
| SMILES | CC(C)CNC(=O)C(=O)NC[C@H](c1cccnc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-12(2)9-19-16(21)17(22)20-11-14(13-5-3-7-18-10-13)26(23,24)15-6-4-8-25-15/h3-8,10,12,14H,9,11H2,1-2H3,(H,19,21)(H,20,22)/t14-/m1/s1 |
| InChIKey | RFKYJUWOJKZSJR-CQSZACIVSA-N |
| XLogP | 1.55 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|