C19H23N3O4S2 — CID 9152883
N'-cyclohexyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]oxamide (PubChem CID 9152883) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is N'-cyclohexyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]oxamide.
| Compound Name | N'-cyclohexyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]oxamide |
|---|---|
| PubChem CID | 9152883 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N'-cyclohexyl-N-[(2R)-2-pyridin-3-yl-2-thiophen-2-ylsulfonylethyl]oxamide |
| SMILES | O=C(NC[C@@H](c1cccnc1)S(=O)(=O)c1cccs1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H23N3O4S2/c23-18(19(24)22-15-7-2-1-3-8-15)21-13-16(14-6-4-10-20-12-14)28(25,26)17-9-5-11-27-17/h4-6,9-12,15-16H,1-3,7-8,13H2,(H,21,23)(H,22,24)/t16-/m0/s1 |
| InChIKey | JMLAQNLXHRQPJD-INIZCTEOSA-N |
| XLogP | 2.22 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|