C20H23N3O4S — CID 9154296
N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-cyclopentyloxamide (PubChem CID 9154296) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-cyclopentyloxamide.
| Compound Name | N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-cyclopentyloxamide |
|---|---|
| PubChem CID | 9154296 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-cyclopentyloxamide |
| SMILES | O=C(NC[C@H](c1cccnc1)S(=O)(=O)c1ccccc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C20H23N3O4S/c24-19(20(25)23-16-8-4-5-9-16)22-14-18(15-7-6-12-21-13-15)28(26,27)17-10-2-1-3-11-17/h1-3,6-7,10-13,16,18H,4-5,8-9,14H2,(H,22,24)(H,23,25)/t18-/m1/s1 |
| InChIKey | FJCWSGNYWLUKFO-GOSISDBHSA-N |
| XLogP | 1.77 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|