C19H23N3O3S — CID 9154047
N-[(2R)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]piperidine-1-carboxamide (PubChem CID 9154047) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[(2R)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]piperidine-1-carboxamide.
| Compound Name | N-[(2R)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 9154047 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[(2R)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]piperidine-1-carboxamide |
| SMILES | O=C(NC[C@@H](c1cccnc1)S(=O)(=O)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C19H23N3O3S/c23-19(22-12-5-2-6-13-22)21-15-18(16-8-7-11-20-14-16)26(24,25)17-9-3-1-4-10-17/h1,3-4,7-11,14,18H,2,5-6,12-13,15H2,(H,21,23)/t18-/m0/s1 |
| InChIKey | NYCJYZGSCJJIAM-SFHVURJKSA-N |
| XLogP | 2.79 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |