C21H25N3O4S — CID 9154333
N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-cyclohexyloxamide (PubChem CID 9154333) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-cyclohexyloxamide.
| Compound Name | N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-cyclohexyloxamide |
|---|---|
| PubChem CID | 9154333 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-cyclohexyloxamide |
| SMILES | O=C(NC[C@H](c1cccnc1)S(=O)(=O)c1ccccc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H25N3O4S/c25-20(21(26)24-17-9-3-1-4-10-17)23-15-19(16-8-7-13-22-14-16)29(27,28)18-11-5-2-6-12-18/h2,5-8,11-14,17,19H,1,3-4,9-10,15H2,(H,23,25)(H,24,26)/t19-/m1/s1 |
| InChIKey | KHWXJFZZJINYHQ-LJQANCHMSA-N |
| XLogP | 2.16 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|