C19H23N3O4S — CID 9154240
N-[(2R)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-[(2S)-butan-2-yl]oxamide (PubChem CID 9154240) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[(2R)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-[(2S)-butan-2-yl]oxamide.
| Compound Name | N-[(2R)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-[(2S)-butan-2-yl]oxamide |
|---|---|
| PubChem CID | 9154240 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[(2R)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]-N'-[(2S)-butan-2-yl]oxamide |
| SMILES | CC[C@H](C)NC(=O)C(=O)NC[C@@H](c1cccnc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-3-14(2)22-19(24)18(23)21-13-17(15-8-7-11-20-12-15)27(25,26)16-9-5-4-6-10-16/h4-12,14,17H,3,13H2,1-2H3,(H,21,23)(H,22,24)/t14-,17-/m0/s1 |
| InChIKey | LZLNAPQVHJBHFK-YOEHRIQHSA-N |
| XLogP | 1.63 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|