C19H25N4O4S+ — CID 9154426
2-[[2-[[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]amino]-2-oxoacetyl]amino]ethyl-dimethylazanium (PubChem CID 9154426) has the molecular formula C19H25N4O4S+ and a molecular weight of 405.50 g/mol. Its IUPAC name is 2-[[2-[[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]amino]-2-oxoacetyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[2-[[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]amino]-2-oxoacetyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 9154426 |
| Molecular Formula | C19H25N4O4S+ |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 2-[[2-[[(2S)-2-(benzenesulfonyl)-2-pyridin-3-ylethyl]amino]-2-oxoacetyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)C(=O)NC[C@H](c1cccnc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24N4O4S/c1-23(2)12-11-21-18(24)19(25)22-14-17(15-7-6-10-20-13-15)28(26,27)16-8-4-3-5-9-16/h3-10,13,17H,11-12,14H2,1-2H3,(H,21,24)(H,22,25)/p+1/t17-/m1/s1 |
| InChIKey | UYLDMPGVWXOKAK-QGZVFWFLSA-O |
| XLogP | -1.03 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|