C17H19N3O4S — CID 9155029
N-methyl-N'-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide (PubChem CID 9155029) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is N-methyl-N'-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N-methyl-N'-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 9155029 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-methyl-N'-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide |
| SMILES | CNC(=O)C(=O)NC[C@H](c1cccnc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H19N3O4S/c1-12-5-7-14(8-6-12)25(23,24)15(13-4-3-9-19-10-13)11-20-17(22)16(21)18-2/h3-10,15H,11H2,1-2H3,(H,18,21)(H,20,22)/t15-/m1/s1 |
| InChIKey | IQXVXFFILJZTFG-OAHLLOKOSA-N |
| XLogP | 0.77 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|