C20H25N3O5S — CID 9156975
N'-[(2S)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-N-(2-methylpropyl)oxamide (PubChem CID 9156975) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is N'-[(2S)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-N-(2-methylpropyl)oxamide.
| Compound Name | N'-[(2S)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 9156975 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N'-[(2S)-2-(4-methoxyphenyl)sulfonyl-2-pyridin-3-ylethyl]-N-(2-methylpropyl)oxamide |
| SMILES | COc1ccc(S(=O)(=O)[C@H](CNC(=O)C(=O)NCC(C)C)c2cccnc2)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-14(2)11-22-19(24)20(25)23-13-18(15-5-4-10-21-12-15)29(26,27)17-8-6-16(28-3)7-9-17/h4-10,12,14,18H,11,13H2,1-3H3,(H,22,24)(H,23,25)/t18-/m1/s1 |
| InChIKey | CZHUNXVAAGLRTK-GOSISDBHSA-N |
| XLogP | 1.49 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|