C19H23N3O5S — CID 9155285
N-(2-methoxyethyl)-N'-[(2R)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide (PubChem CID 9155285) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N'-[(2R)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N-(2-methoxyethyl)-N'-[(2R)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 9155285 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-(2-methoxyethyl)-N'-[(2R)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide |
| SMILES | COCCNC(=O)C(=O)NC[C@@H](c1cccnc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-14-5-7-16(8-6-14)28(25,26)17(15-4-3-9-20-12-15)13-22-19(24)18(23)21-10-11-27-2/h3-9,12,17H,10-11,13H2,1-2H3,(H,21,23)(H,22,24)/t17-/m0/s1 |
| InChIKey | CRDPLJSHHPASFW-KRWDZBQOSA-N |
| XLogP | 0.78 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|