C20H25N3O5S — CID 9155308
N-(3-methoxypropyl)-N'-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide (PubChem CID 9155308) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-(3-methoxypropyl)-N'-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide.
| Compound Name | N-(3-methoxypropyl)-N'-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide |
|---|---|
| PubChem CID | 9155308 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-(3-methoxypropyl)-N'-[(2S)-2-(4-methylphenyl)sulfonyl-2-pyridin-3-ylethyl]oxamide |
| SMILES | COCCCNC(=O)C(=O)NC[C@H](c1cccnc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-15-6-8-17(9-7-15)29(26,27)18(16-5-3-10-21-13-16)14-23-20(25)19(24)22-11-4-12-28-2/h3,5-10,13,18H,4,11-12,14H2,1-2H3,(H,22,24)(H,23,25)/t18-/m1/s1 |
| InChIKey | XBQJFKNDNRIOTB-GOSISDBHSA-N |
| XLogP | 1.17 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|